Abstract: Two novel β-Diketinimatonickel complexes [NiL2](L=HNC(Ph)CHC(Ph)NH)(2) and [NiL′2](L′=HNC(Ph)CHC(tBu)NH)(4) were synthesised and the crystal structure of complexes (2) was determined by single crystal X-ray structure analysis. The crystal data are as follows: NiC30H26N4·2(C2H5OC2H5), FW=649.50, orthorhombic, space group Pbca, a=11.2243(14), b=17.236(2), c=18.429(2)?, α=90°,β=90°,γ=90°, V=33565.2(7)?3, Z=4, Dc=1.210 g·cm3, μ=5.81 cm-1, F(000)=1384, T=294(2)K. 4542 unique reflections [I>2σ(I)], R=0.0297, wR=0.0826. |